CAS 1993226-92-8 is the registry number for Methyl 5-chloro-1,6-naphthyridine-7-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-chloro-1,6-naphthyridine-7-carboxylate (CAS 1993226-92-8) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: methyl 5-chloro-1,6-naphthyridine-7-carboxylate. InChIKey: GHBULFLEAIVMSM-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | methyl 5-chloro-1,6-naphthyridine-7-carboxylate |
| InChIKey | GHBULFLEAIVMSM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C2C=CC=NC2=C1)Cl |
Computed by PubChem (NCBI)