CAS 19943-16-9 appears in our catalog under these names: (3S,6S)-3,6-Diisopropylpiperazine-2,5-dione, 95%, Cyclo-L-Val-L-Val, Cyclo(–Val–Val), Cyclo(-Val-Val) 95%, (3S,6S)-3,6-Diisopropylpiperazine-2,5-dione, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3S,6S)-3,6-di(propan-2-yl)piperazine-2,5-dione (CAS 19943-16-9) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: (3S,6S)-3,6-di(propan-2-yl)piperazine-2,5-dione. InChIKey: QGMAWEIDGADSAC-YUMQZZPRSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | (3S,6S)-3,6-di(propan-2-yl)piperazine-2,5-dione |
| InChIKey | QGMAWEIDGADSAC-YUMQZZPRSA-N |
| SMILES | CC(C)[C@H]1C(=O)N[C@H](C(=O)N1)C(C)C |
Computed by PubChem (NCBI)