Products 5625-44-5
CAS 5625-44-5 is the registry number for 3,6-Diisopropyl-2,5-Piperazinedione. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-di(propan-2-yl)piperazine-2,5-dione (CAS 5625-44-5) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: 3,6-di(propan-2-yl)piperazine-2,5-dione. InChIKey: QGMAWEIDGADSAC-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 3,6-di(propan-2-yl)piperazine-2,5-dione |
| InChIKey | QGMAWEIDGADSAC-UHFFFAOYSA-N |
| SMILES | CC(C)C1C(=O)NC(C(=O)N1)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
Valylvaline anhydride, Cyclo(valylvalyl), 3,6-di(propan-2-yl)piperazine-2,5-dione, L-Valyl-valine anhydride, 3,6-diisopropylpiperazine-2,5-dione, 3,6-Diisopropyl-2,5-piperazinedione, 2,5-Piperazinedione, 3,6-bis(1-methylethyl)-, Cyclo(L-Val-L-Val), (3S,6S)-3,6-bis(propan-2-yl)piperazine-2,5-dione, orb3179240