Products 1994304-88-9
CAS 1994304-88-9 is the registry number for L-Cysteine-13C3,15N,d3. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.
(2R)-2-(15N)azanyl-2,3,3-trideuterio-3-sulfanyl(1,2,3-13C3)propanoic acid (CAS 1994304-88-9) is a chemical compound with the molecular formula C3H7NO2S and a molecular weight of 128.15 g/mol. IUPAC name: (2R)-2-(15N)azanyl-2,3,3-trideuterio-3-sulfanyl(1,2,3-13C3)propanoic acid. InChIKey: XUJNEKJLAYXESH-UXVMDEDXSA-N.
| Molecular formula | C3H7NO2S |
|---|---|
| Molecular weight | 128.15 g/mol |
| IUPAC name | (2R)-2-(15N)azanyl-2,3,3-trideuterio-3-sulfanyl(1,2,3-13C3)propanoic acid |
| InChIKey | XUJNEKJLAYXESH-UXVMDEDXSA-N |
| SMILES | [2H][13C@@]([13C](=O)O)([13C]([2H])([2H])S)[15NH2] |
Computed by PubChem (NCBI)