CAS 70003-50-8 is the registry number for Methyl 2,3-di-O-acetyl-b-D-xylopyranoside. Offered by: Biosynth. Available pack sizes: 10g, 5g.
[(2R,3R,4S,5R)-3-acetyloxy-5-hydroxy-2-methoxyoxan-4-yl] acetate (CAS 70003-50-8) is a chemical compound with the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. IUPAC name: [(2R,3R,4S,5R)-3-acetyloxy-5-hydroxy-2-methoxyoxan-4-yl] acetate. InChIKey: LOEWJQHJKPVKSG-UTINFBMNSA-N.
| Molecular formula | C10H16O7 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-3-acetyloxy-5-hydroxy-2-methoxyoxan-4-yl] acetate |
| InChIKey | LOEWJQHJKPVKSG-UTINFBMNSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H](CO[C@H]([C@@H]1OC(=O)C)OC)O |
Computed by PubChem (NCBI)