Products 1899809-47-2
CAS 1899809-47-2 is the registry number for (2R)-2-amino-5-oxo-5-(tritylamino)pentanoic acid,hydrate, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g, 50g, 100g.
(2R)-2-amino-5-oxo-5-(tritylamino)pentanoic acid;hydrate (CAS 1899809-47-2) is a chemical compound with the molecular formula C24H26N2O4 and a molecular weight of 406.5 g/mol. IUPAC name: (2R)-2-amino-5-oxo-5-(tritylamino)pentanoic acid;hydrate. InChIKey: UKMVWWMCFNOINR-ZMBIFBSDSA-N.
| Molecular formula | C24H26N2O4 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | (2R)-2-amino-5-oxo-5-(tritylamino)pentanoic acid;hydrate |
| InChIKey | UKMVWWMCFNOINR-ZMBIFBSDSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)CC[C@H](C(=O)O)N.O |
Computed by PubChem (NCBI)