Products 1997321-76-2
CAS 1997321-76-2 is the registry number for PBRM1/SMARCA2,4-ligand-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(6-amino-5-phenylpyridazin-3-yl)phenol (CAS 1997321-76-2) is a chemical compound with the molecular formula C16H13N3O and a molecular weight of 263.29 g/mol. IUPAC name: 2-(6-amino-5-phenylpyridazin-3-yl)phenol. InChIKey: SDAWPVIWTVUTCC-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 2-(6-amino-5-phenylpyridazin-3-yl)phenol |
| InChIKey | SDAWPVIWTVUTCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NN=C2N)C3=CC=CC=C3O |
Computed by PubChem (NCBI)