Products 1997468-84-4
CAS 1997468-84-4 is the registry number for Boc-L-Phe(2,4,5-Me3)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg, 1g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,4,5-trimethylphenyl)propanoic acid (CAS 1997468-84-4) is a chemical compound with the molecular formula C17H25NO4 and a molecular weight of 307.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,4,5-trimethylphenyl)propanoic acid. InChIKey: MPRIZSRAOVFQIW-AWEZNQCLSA-N.
| Molecular formula | C17H25NO4 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,4,5-trimethylphenyl)propanoic acid |
| InChIKey | MPRIZSRAOVFQIW-AWEZNQCLSA-N |
| SMILES | CC1=CC(=C(C=C1C)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)