Products 1998216-00-4
CAS 1998216-00-4 appears in our catalog under these names: 3-(Piperazin-1-yl)benzoic acid hydrochloride, 95%, 3–(Piperazin–1–yl)benzoic acid hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 10g, 1g.
3-piperazin-1-ylbenzoic acid;hydrochloride (CAS 1998216-00-4) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: 3-piperazin-1-ylbenzoic acid;hydrochloride. InChIKey: WUIPIWUUGYGNDI-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 3-piperazin-1-ylbenzoic acid;hydrochloride |
| InChIKey | WUIPIWUUGYGNDI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=CC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)