CAS 19988-42-2 is the registry number for (1S,3R)-3-Phenylcyclohexanamine Hydrochloride. Offered by: TRC. Available pack sizes: 50mg.
Cis-(1R,3S)-3-phenylcyclohexan-1-amine;hydrochloride (CAS 19988-42-2) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: cis-(1R,3S)-3-phenylcyclohexan-1-amine;hydrochloride. InChIKey: LSTROUZBDJNGLG-ZVWHLABXSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | cis-(1R,3S)-3-phenylcyclohexan-1-amine;hydrochloride |
| InChIKey | LSTROUZBDJNGLG-ZVWHLABXSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)