CAS 1999897-65-2 is the registry number for 2'-Chloro-5'-methyl-[1,1'-biphenyl]-3-carbaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-(2-chloro-5-methylphenyl)benzaldehyde (CAS 1999897-65-2) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 3-(2-chloro-5-methylphenyl)benzaldehyde. InChIKey: WWNJUUSXVYKWEA-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 3-(2-chloro-5-methylphenyl)benzaldehyde |
| InChIKey | WWNJUUSXVYKWEA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Cl)C2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)