CAS 200002-41-1 appears in our catalog under these names: Peramivir Impurity 83, (1S,4R)-tert-Butyl 3-oxo-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 1g, 5g.
Tert-butyl (1S,4R)-3-oxo-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate (CAS 200002-41-1) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: tert-butyl (1S,4R)-3-oxo-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate. InChIKey: NQIZWJGHIYDHRL-JGVFFNPUSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | tert-butyl (1S,4R)-3-oxo-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| InChIKey | NQIZWJGHIYDHRL-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2C[C@@H](C1=O)C=C2 |
Computed by PubChem (NCBI)