Products 200116-26-3
CAS 200116-26-3 is the registry number for 5,5-Diethyl-1,3-diphenyl-2-iminobarbituric Acid. Offered by: TRC. Available pack sizes: 100mg, 10mg.
5,5-diethyl-2-imino-1,3-diphenyl-1,3-diazinane-4,6-dione (CAS 200116-26-3) is a chemical compound with the molecular formula C20H21N3O2 and a molecular weight of 335.4 g/mol. IUPAC name: 5,5-diethyl-2-imino-1,3-diphenyl-1,3-diazinane-4,6-dione. InChIKey: UOVOTAJFAYMIHH-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O2 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 5,5-diethyl-2-imino-1,3-diphenyl-1,3-diazinane-4,6-dione |
| InChIKey | UOVOTAJFAYMIHH-UHFFFAOYSA-N |
| SMILES | CCC1(C(=O)N(C(=N)N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3)CC |
Computed by PubChem (NCBI)