CAS 57101-60-7 is the registry number for Bzl-his(bzl)-oh, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S)-2-(benzylamino)-3-(1-benzylimidazol-4-yl)propanoic acid (CAS 57101-60-7) is a chemical compound with the molecular formula C20H21N3O2 and a molecular weight of 335.4 g/mol. IUPAC name: (2S)-2-(benzylamino)-3-(1-benzylimidazol-4-yl)propanoic acid. InChIKey: IUSLFTWXUDAXJI-IBGZPJMESA-N.
| Molecular formula | C20H21N3O2 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (2S)-2-(benzylamino)-3-(1-benzylimidazol-4-yl)propanoic acid |
| InChIKey | IUSLFTWXUDAXJI-IBGZPJMESA-N |
| SMILES | C1=CC=C(C=C1)CN[C@@H](CC2=CN(C=N2)CC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)