Products 3046141-72-1
CAS 3046141-72-1 is the registry number for Decarboxamide Finerenone. Offered by: TRC. Available pack sizes: 25mg.
4-(5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridin-4-yl)-3-methoxybenzonitrile (CAS 3046141-72-1) is a chemical compound with the molecular formula C20H21N3O2 and a molecular weight of 335.4 g/mol. IUPAC name: 4-(5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridin-4-yl)-3-methoxybenzonitrile. InChIKey: HXNKXKNIZDPQBC-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O2 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-(5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridin-4-yl)-3-methoxybenzonitrile |
| InChIKey | HXNKXKNIZDPQBC-UHFFFAOYSA-N |
| SMILES | CCOC1=NC=C(C2=C1C(C=C(N2)C)C3=C(C=C(C=C3)C#N)OC)C |
Computed by PubChem (NCBI)