Products 75000-24-7

CAS 75000-24-7 is the registry number for 2-(2-(1-Phenylpiperidin-4-yl)ethyl)isoindoline-1,3-dione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

2-[2-(4-phenylpiperazin-1-yl)ethyl]isoindole-1,3-dione (CAS 75000-24-7) is a chemical compound with the molecular formula C20H21N3O2 and a molecular weight of 335.4 g/mol. IUPAC name: 2-[2-(4-phenylpiperazin-1-yl)ethyl]isoindole-1,3-dione. InChIKey: XJIVMDLRFJXHEY-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21N3O2
Molecular weight335.4 g/mol
IUPAC name2-[2-(4-phenylpiperazin-1-yl)ethyl]isoindole-1,3-dione
InChIKeyXJIVMDLRFJXHEY-UHFFFAOYSA-N
SMILESC1CN(CCN1CCN2C(=O)C3=CC=CC=C3C2=O)C4=CC=CC=C4

Computed by PubChem (NCBI)