CAS 200482-54-8 is the registry number for 7-Amino-3-chloroindole hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 1g.
3-chloro-1H-indol-7-amine;hydrochloride (CAS 200482-54-8) is a chemical compound with the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. IUPAC name: 3-chloro-1H-indol-7-amine;hydrochloride. InChIKey: CCDREQPJNRWDNR-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2 |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | 3-chloro-1H-indol-7-amine;hydrochloride |
| InChIKey | CCDREQPJNRWDNR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)NC=C2Cl.Cl |
Computed by PubChem (NCBI)