Products 200490-80-8
CAS 200490-80-8 is the registry number for 3-{((tert-Butoxy)carbonyl)amino}-2,2-dimethylpentanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 200490-80-8) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: QVRMQQOUFDQKIH-UHFFFAOYSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | QVRMQQOUFDQKIH-UHFFFAOYSA-N |
| SMILES | CCC(C(C)(C)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)