CAS 200575-16-2 appears in our catalog under these names: 5–(Chlorosulfonyl)–2–ethoxybenzoic acid, 5-(Chlorosulfonyl)-2-ethoxybenzoic acid, 5-(Chlorosulfonyl)-2-ethoxybenzoic acid 95%, 5-(Chlorosulfonyl)-2-ethoxybenzoic acid, 98%, 5-(Chlorosulfonyl)-2-ethoxybenzoic acid, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 100g, 1g, 250mg, 25g, 5g, 10g, 2.5g.
5-chlorosulfonyl-2-ethoxybenzoic acid (CAS 200575-16-2) is a chemical compound with the molecular formula C9H9ClO5S and a molecular weight of 264.68 g/mol. IUPAC name: 5-chlorosulfonyl-2-ethoxybenzoic acid. InChIKey: UHNRCKXZRULNSC-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO5S |
|---|---|
| Molecular weight | 264.68 g/mol |
| IUPAC name | 5-chlorosulfonyl-2-ethoxybenzoic acid |
| InChIKey | UHNRCKXZRULNSC-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)