Products 200630-96-2
CAS 200630-96-2 appears in our catalog under these names: Zaleplon Impurity 11, Zaleplon Impurity 7, N-(3-Acetylphenyl)-N-ethylacetamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g, 250mg.
N-(3-acetylphenyl)-N-ethylacetamide (CAS 200630-96-2) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: N-(3-acetylphenyl)-N-ethylacetamide. InChIKey: UDHSUNANTLODHO-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | N-(3-acetylphenyl)-N-ethylacetamide |
| InChIKey | UDHSUNANTLODHO-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=CC(=C1)C(=O)C)C(=O)C |
Computed by PubChem (NCBI)