CAS 2007081-99-2 appears in our catalog under these names: 2-Nitro-6,7-dihydropyrazolo[1,5-a]pyridine, 95%, 2-Nitro-6,7-dihydropyrazolo(1,5-a)pyridine, 97%, 2-NITRO-6,7-DIHYDROPYRAZOLO[1,5-A]PYRIDINE, >97%, 2-Nitro-6,7-dihydropyrazolo[1,5-a]pyridine, >97%, >97%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g.
2-nitro-6,7-dihydropyrazolo[1,5-a]pyridine (CAS 2007081-99-2) is a chemical compound with the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. IUPAC name: 2-nitro-6,7-dihydropyrazolo[1,5-a]pyridine. InChIKey: RLLZSMFVIMQVIO-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2-nitro-6,7-dihydropyrazolo[1,5-a]pyridine |
| InChIKey | RLLZSMFVIMQVIO-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC(=N2)[N+](=O)[O-])C=C1 |
Computed by PubChem (NCBI)