CAS 959238-51-8 is the registry number for 2,5-Dimethyl[1,3]oxazolo[5,4-d]pyrimidin-7(6h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2,5-dimethyl-6H-[1,3]oxazolo[5,4-d]pyrimidin-7-one (CAS 959238-51-8) is a chemical compound with the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. IUPAC name: 2,5-dimethyl-6H-[1,3]oxazolo[5,4-d]pyrimidin-7-one. InChIKey: AXSUVXXGOZEMQW-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2,5-dimethyl-6H-[1,3]oxazolo[5,4-d]pyrimidin-7-one |
| InChIKey | AXSUVXXGOZEMQW-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=O)N1)N=C(O2)C |
Computed by PubChem (NCBI)