CAS 4663-96-1 is the registry number for Pyridine-2,5-dicarboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Pyridine-2,5-dicarboxamide (CAS 4663-96-1) is a chemical compound with the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. IUPAC name: pyridine-2,5-dicarboxamide. InChIKey: LEIAZUKOBVWTEH-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | pyridine-2,5-dicarboxamide |
| InChIKey | LEIAZUKOBVWTEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)N)C(=O)N |
Computed by PubChem (NCBI)