CAS 4663-97-2 appears in our catalog under these names: 2,6-PYRIDINEDICARBOXAMIDE, 97%, Pyridine-2,6-dicarboxamide, 97%, Pyridine-2,6-dicarboxamide, 98%, Pyridine-2,6-dicarboxamide, 98%, 98%. Offered by: Sigma-Aldrich, Ambeed, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10G, 250mg, 1g, 5g, 25g, 100mg.
Pyridine-2,6-dicarboxamide (CAS 4663-97-2) is a chemical compound with the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. IUPAC name: pyridine-2,6-dicarboxamide. InChIKey: UUVCRNTVNKTNRK-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | pyridine-2,6-dicarboxamide |
| InChIKey | UUVCRNTVNKTNRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)N)C(=O)N |
Computed by PubChem (NCBI)