CAS 20076-54-4 appears in our catalog under these names: 5,6-Dichloro-2-(methylthio)-1h-benzo[d]imidazole, 98%, 5,6-Dichloro-2-(methylthio)-1H-benzo(d)imidazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
5,6-dichloro-2-methylsulfanyl-1H-benzimidazole (CAS 20076-54-4) is a chemical compound with the molecular formula C8H6Cl2N2S and a molecular weight of 233.12 g/mol. IUPAC name: 5,6-dichloro-2-methylsulfanyl-1H-benzimidazole. InChIKey: OBYWDNBOQUIKNW-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2S |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | 5,6-dichloro-2-methylsulfanyl-1H-benzimidazole |
| InChIKey | OBYWDNBOQUIKNW-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=CC(=C(C=C2N1)Cl)Cl |
Computed by PubChem (NCBI)