CAS 886047-53-6 appears in our catalog under these names: 2,5-Dichloro-4-methyl-6-(methylthio)nicotinonitrile, 95%, 2，5-Dichloro-4-Methyl-6-(Methylthio)Nicotinonitrile, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2,5-dichloro-4-methyl-6-methylsulfanylpyridine-3-carbonitrile (CAS 886047-53-6) is a chemical compound with the molecular formula C8H6Cl2N2S and a molecular weight of 233.12 g/mol. IUPAC name: 2,5-dichloro-4-methyl-6-methylsulfanylpyridine-3-carbonitrile. InChIKey: MRILYUBRJRJWGO-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2S |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | 2,5-dichloro-4-methyl-6-methylsulfanylpyridine-3-carbonitrile |
| InChIKey | MRILYUBRJRJWGO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1Cl)SC)Cl)C#N |
Computed by PubChem (NCBI)