CAS 42518-42-3 appears in our catalog under these names: 2,4-Dichloro-5,6-dimethylthieno[2,3-d]pyrimidine, 95%, 2,4-Dichloro-5,6-dimethylthieno[2,3-d]pyrimidine, 97%, 97%, 2,4-Dichloro-5,6-dimethylthieno[2,3-d]pyrimidine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 25g, 100g.
2,4-dichloro-5,6-dimethylthieno[2,3-d]pyrimidine (CAS 42518-42-3) is a chemical compound with the molecular formula C8H6Cl2N2S and a molecular weight of 233.12 g/mol. IUPAC name: 2,4-dichloro-5,6-dimethylthieno[2,3-d]pyrimidine. InChIKey: LDXCWOSUWRNYEW-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2S |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | 2,4-dichloro-5,6-dimethylthieno[2,3-d]pyrimidine |
| InChIKey | LDXCWOSUWRNYEW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=NC(=N2)Cl)Cl)C |
Computed by PubChem (NCBI)