CAS 87478-74-8 appears in our catalog under these names: 2,4-Dichloro-6-ethylthieno[2,3-d]pyrimidine, 95%, 2,4-Dichloro-6-ethylthieno(2,3-d)pyrimidine, 98%, 2,4-Dichloro-6-ethylthieno[2,3-d]pyrimidine, 97%, 97%, 2,4-Dichloro-6-ethylthieno[2,3-d]pyrimidine, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
2,4-dichloro-6-ethylthieno[2,3-d]pyrimidine (CAS 87478-74-8) is a chemical compound with the molecular formula C8H6Cl2N2S and a molecular weight of 233.12 g/mol. IUPAC name: 2,4-dichloro-6-ethylthieno[2,3-d]pyrimidine. InChIKey: WILLJMUZTUFCPD-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2S |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | 2,4-dichloro-6-ethylthieno[2,3-d]pyrimidine |
| InChIKey | WILLJMUZTUFCPD-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(S1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)