CAS 2007909-63-7 is the registry number for (S)-Benzyl (4-methyl-1-oxo-1-phenylpentan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
Benzyl N-[(2S)-4-methyl-1-oxo-1-phenylpentan-2-yl]carbamate (CAS 2007909-63-7) is a chemical compound with the molecular formula C20H23NO3 and a molecular weight of 325.4 g/mol. IUPAC name: benzyl N-[(2S)-4-methyl-1-oxo-1-phenylpentan-2-yl]carbamate. InChIKey: RVCRHLZVEPSRFZ-SFHVURJKSA-N.
| Molecular formula | C20H23NO3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | benzyl N-[(2S)-4-methyl-1-oxo-1-phenylpentan-2-yl]carbamate |
| InChIKey | RVCRHLZVEPSRFZ-SFHVURJKSA-N |
| SMILES | CC(C)C[C@@H](C(=O)C1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)