CAS 2007910-70-3 appears in our catalog under these names: tert-Butyl [3,3'-biazetidine]-1-carboxylate hydrochloride, 95%, tert-butyl (3,3'-Biazetidine)-1-carboxylate HCl, [3,3'-Biazetidine]-1-carboxylic acid, 1,1-dimethylethyl ester, hydrochloride (1:1), 97%, 97%, tert-Butyl [3,3'-biazetidine]-1-carboxylate hydrochloride, tert-butyl [3,3'-biazetidine]-1-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg, 50mg, 5g, Get quote.
Tert-butyl 3-(azetidin-3-yl)azetidine-1-carboxylate;hydrochloride (CAS 2007910-70-3) is a chemical compound with the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. IUPAC name: tert-butyl 3-(azetidin-3-yl)azetidine-1-carboxylate;hydrochloride. InChIKey: HODOSLOMSNCLOP-UHFFFAOYSA-N.
| Molecular formula | C11H21ClN2O2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | tert-butyl 3-(azetidin-3-yl)azetidine-1-carboxylate;hydrochloride |
| InChIKey | HODOSLOMSNCLOP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2CNC2.Cl |
Computed by PubChem (NCBI)