Products 2007920-58-1

CAS 2007920-58-1 is the registry number for 2-(3-(Ethoxycarbonyl)-4-methyl-1h-pyrazol-1-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-ethoxycarbonyl-4-methylpyrazol-1-yl)benzoic acid (CAS 2007920-58-1) is a chemical compound with the molecular formula C14H14N2O4 and a molecular weight of 274.27 g/mol. IUPAC name: 2-(3-ethoxycarbonyl-4-methylpyrazol-1-yl)benzoic acid. InChIKey: GPLFVJYYQNEZOK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14N2O4
Molecular weight274.27 g/mol
IUPAC name2-(3-ethoxycarbonyl-4-methylpyrazol-1-yl)benzoic acid
InChIKeyGPLFVJYYQNEZOK-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NN(C=C1C)C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)