Products 354815-34-2
CAS 354815-34-2 is the registry number for 6-Methyl-8-nitro-3a,4,5,9b-tetrahydro-3h-cyclopenta[c]quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-methyl-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid (CAS 354815-34-2) is a chemical compound with the molecular formula C14H14N2O4 and a molecular weight of 274.27 g/mol. IUPAC name: 6-methyl-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid. InChIKey: FQMGHDYQCQVRST-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O4 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | 6-methyl-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid |
| InChIKey | FQMGHDYQCQVRST-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(C3C2C=CC3)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)