Products 2270905-18-3

CAS 2270905-18-3 is the registry number for 3-Morpholin-4-yl-5-phenylisoxazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-morpholin-4-yl-5-phenyl-1,2-oxazole-4-carboxylic acid (CAS 2270905-18-3) is a chemical compound with the molecular formula C14H14N2O4 and a molecular weight of 274.27 g/mol. IUPAC name: 3-morpholin-4-yl-5-phenyl-1,2-oxazole-4-carboxylic acid. InChIKey: AWCLMCDCNJVRQY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14N2O4
Molecular weight274.27 g/mol
IUPAC name3-morpholin-4-yl-5-phenyl-1,2-oxazole-4-carboxylic acid
InChIKeyAWCLMCDCNJVRQY-UHFFFAOYSA-N
SMILESC1COCCN1C2=NOC(=C2C(=O)O)C3=CC=CC=C3

Computed by PubChem (NCBI)