CAS 321970-25-6 appears in our catalog under these names: Dimethyl 1-benzyl-1h-imidazole-4,5-dicarboxylate, 95%, Dimethyl 1-benzyl-1H-imidazole-4,5-dicarboxylate, 95+%, Dimethyl 1–benzyl–1H–imidazole–4,5–dicarboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Dimethyl 1-benzylimidazole-4,5-dicarboxylate (CAS 321970-25-6) is a chemical compound with the molecular formula C14H14N2O4 and a molecular weight of 274.27 g/mol. IUPAC name: dimethyl 1-benzylimidazole-4,5-dicarboxylate. InChIKey: AQLGPELKQBCWGJ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O4 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | dimethyl 1-benzylimidazole-4,5-dicarboxylate |
| InChIKey | AQLGPELKQBCWGJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N(C=N1)CC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)