CAS 200871-52-9 appears in our catalog under these names: Boc-d-his(1-me)-oh, 95%, Boc–D–His(1–Me)–OH, Boc-D-His(1-Me)-OH. Offered by: Combi-blocks, GLPBio, Iris Biotech. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-3-(1-methylimidazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 200871-52-9) is a chemical compound with the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. IUPAC name: (2R)-3-(1-methylimidazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: UCKFPCXOYMKRSO-SECBINFHSA-N.
| Molecular formula | C12H19N3O4 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | (2R)-3-(1-methylimidazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | UCKFPCXOYMKRSO-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CN(C=N1)C)C(=O)O |
Computed by PubChem (NCBI)