CAS 2349949-49-9 appears in our catalog under these names: (2S)-2-{[(tert-butoxy)carbonyl]amino}-2-(1-ethyl-1H-pyrazol-4-yl)acetic acid, 95%, (S)-2-((TERT-BUTOXYCARBONYL)AMINO)-2-(1-ETHYL-1H-PYRAZOL-4-YL)ACETIC ACID, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
(2S)-2-(1-ethylpyrazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 2349949-49-9) is a chemical compound with the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. IUPAC name: (2S)-2-(1-ethylpyrazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: YYMXNDDPVQXDEF-VIFPVBQESA-N.
| Molecular formula | C12H19N3O4 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | (2S)-2-(1-ethylpyrazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | YYMXNDDPVQXDEF-VIFPVBQESA-N |
| SMILES | CCN1C=C(C=N1)[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)