Products 2723435-55-8
CAS 2723435-55-8 is the registry number for Methyl 3-(2-acetyl-6-oxo-2,5-diazaspiro[3.4]octan-7-yl)-2-aminopropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(2-acetyl-6-oxo-2,5-diazaspiro[3.4]octan-7-yl)-2-aminopropanoate (CAS 2723435-55-8) is a chemical compound with the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. IUPAC name: methyl 3-(2-acetyl-6-oxo-2,5-diazaspiro[3.4]octan-7-yl)-2-aminopropanoate. InChIKey: VQFITNUWGCNPLR-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O4 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | methyl 3-(2-acetyl-6-oxo-2,5-diazaspiro[3.4]octan-7-yl)-2-aminopropanoate |
| InChIKey | VQFITNUWGCNPLR-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2(C1)CC(C(=O)N2)CC(C(=O)OC)N |
Computed by PubChem (NCBI)