CAS 61070-22-2 appears in our catalog under these names: Boc-his(3-me)-oh, 98%, Boc–His(Nτ–Me)–OH, Boc-L-His(3-Me)-OH, Boc-His(3-Me)-OH 98%, BOC-HIS(3-ME)-OH, 98%, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100g, 25g, 5g, 100mg.
(2S)-3-(3-methylimidazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 61070-22-2) is a chemical compound with the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. IUPAC name: (2S)-3-(3-methylimidazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: BGZFLUIZBZNCTI-VIFPVBQESA-N.
| Molecular formula | C12H19N3O4 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | (2S)-3-(3-methylimidazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | BGZFLUIZBZNCTI-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CN=CN1C)C(=O)O |
Computed by PubChem (NCBI)