Products 200956-57-6
CAS 200956-57-6 is the registry number for Benzoic acid, 3-bromo-4-(2,2,2-trifluoroethoxy)-, methyl ester, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-bromo-4-(2,2,2-trifluoroethoxy)benzoate (CAS 200956-57-6) is a chemical compound with the molecular formula C10H8BrF3O3 and a molecular weight of 313.07 g/mol. IUPAC name: methyl 3-bromo-4-(2,2,2-trifluoroethoxy)benzoate. InChIKey: GKKCZRLUNZHVAE-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O3 |
|---|---|
| Molecular weight | 313.07 g/mol |
| IUPAC name | methyl 3-bromo-4-(2,2,2-trifluoroethoxy)benzoate |
| InChIKey | GKKCZRLUNZHVAE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)