Products 201014-45-1
CAS 201014-45-1 is the registry number for Methyl 3’-O-benzyl xyloriboside. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,4R,5R)-5-(hydroxymethyl)-2-methoxy-4-phenylmethoxyoxolan-3-ol (CAS 201014-45-1) is a chemical compound with the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. IUPAC name: (3R,4R,5R)-5-(hydroxymethyl)-2-methoxy-4-phenylmethoxyoxolan-3-ol. InChIKey: NBVZHEHFHYANST-FKJOKYEKSA-N.
| Molecular formula | C13H18O5 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (3R,4R,5R)-5-(hydroxymethyl)-2-methoxy-4-phenylmethoxyoxolan-3-ol |
| InChIKey | NBVZHEHFHYANST-FKJOKYEKSA-N |
| SMILES | COC1[C@@H]([C@H]([C@H](O1)CO)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)