Products 20118-35-8
CAS 20118-35-8 is the registry number for 4-(3-PHENYLPROP-2-ENOYL)BENZOIC ACID, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[(E)-3-phenylprop-2-enoyl]benzoic acid (CAS 20118-35-8) is a chemical compound with the molecular formula C16H12O3 and a molecular weight of 252.26 g/mol. IUPAC name: 4-[(E)-3-phenylprop-2-enoyl]benzoic acid. InChIKey: XXFQFMHIIWSQAL-IZZDOVSWSA-N.
| Molecular formula | C16H12O3 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 4-[(E)-3-phenylprop-2-enoyl]benzoic acid |
| InChIKey | XXFQFMHIIWSQAL-IZZDOVSWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(3-Phenylprop-2-enoyl)benzoic acid, Benzoic acid, 4-(1-oxo-3-phenyl-2-propenyl)-, 4-[(E)-3-phenylprop-2-enoyl]benzoic Acid, 4-[(2E)-3-phenylprop-2-enoyl]benzoic acid, 4-((2E)-3-phenylprop-2-enoyl)benzoic acid, 4-cinnamoylbenzoic acid, 4-(3-Phenylacryloyl)benzoic acid, XXFQFMHIIWSQAL-IZZDOVSWSA-N