Products 2013343-89-8
CAS 2013343-89-8 is the registry number for 4-(1-Benzyl-1H-pyrazol-4-yl)-4-oxobutanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(1-benzylpyrazol-4-yl)-4-oxobutanoic acid (CAS 2013343-89-8) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: 4-(1-benzylpyrazol-4-yl)-4-oxobutanoic acid. InChIKey: LHPXAXCUUJSTLH-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 4-(1-benzylpyrazol-4-yl)-4-oxobutanoic acid |
| InChIKey | LHPXAXCUUJSTLH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=N2)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)