CAS 201611-92-9 appears in our catalog under these names: 4-Cyano-4-(thiobenzoylthio)pentanoic acid, 98%, 4-Cyano-4-(phenylcarbonothioylthio)pentanoic Acid, >95% (HPLC), 4–Cyano–4–(phenylcarbonothioylthio)pentanoic Acid, 4-Cyano-4-((phenylcarbonothioyl)thio)pentanoic acid, 4-Cyano-4-[(phenylcarbonothioyl)thio]pentanoic Acid, >95.0%(T)(HPLC). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 10g, 250mg, 25g, 1g, 5g, 500mg, 100g, 50g.
4-(benzenecarbonothioylsulfanyl)-4-cyanopentanoic acid (CAS 201611-92-9) is a chemical compound with the molecular formula C13H13NO2S2 and a molecular weight of 279.4 g/mol. IUPAC name: 4-(benzenecarbonothioylsulfanyl)-4-cyanopentanoic acid. InChIKey: YNKQCPNHMVAWHN-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2S2 |
|---|---|
| Molecular weight | 279.4 g/mol |
| IUPAC name | 4-(benzenecarbonothioylsulfanyl)-4-cyanopentanoic acid |
| InChIKey | YNKQCPNHMVAWHN-UHFFFAOYSA-N |
| SMILES | CC(CCC(=O)O)(C#N)SC(=S)C1=CC=CC=C1 |
Computed by PubChem (NCBI)