Products 352540-00-2
CAS 352540-00-2 is the registry number for (5E)-5-(2-Isopropoxybenzylidene)-2-mercapto-1,3-thiazol-4(5h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(5E)-5-[(2-propan-2-yloxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 352540-00-2) is a chemical compound with the molecular formula C13H13NO2S2 and a molecular weight of 279.4 g/mol. IUPAC name: (5E)-5-[(2-propan-2-yloxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: BBIHLIJOGGGVLQ-YRNVUSSQSA-N.
| Molecular formula | C13H13NO2S2 |
|---|---|
| Molecular weight | 279.4 g/mol |
| IUPAC name | (5E)-5-[(2-propan-2-yloxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | BBIHLIJOGGGVLQ-YRNVUSSQSA-N |
| SMILES | CC(C)OC1=CC=CC=C1/C=C/2\C(=O)NC(=S)S2 |
Computed by PubChem (NCBI)