Products 380564-75-0

CAS 380564-75-0 is the registry number for 2-(((2-Phenylthiazol-4-yl)methyl)thio)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2-phenyl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid (CAS 380564-75-0) is a chemical compound with the molecular formula C13H13NO2S2 and a molecular weight of 279.4 g/mol. IUPAC name: 2-[(2-phenyl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid. InChIKey: WFNIYYBGSXOWTN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO2S2
Molecular weight279.4 g/mol
IUPAC name2-[(2-phenyl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid
InChIKeyWFNIYYBGSXOWTN-UHFFFAOYSA-N
SMILESCC(C(=O)O)SCC1=CSC(=N1)C2=CC=CC=C2

Computed by PubChem (NCBI)