Products 958009-38-6
CAS 958009-38-6 is the registry number for 4-Methyl-N-(1-(2-thienyl)ethylidene)benzenesulfonamide. Offered by: TRC. Available pack sizes: 2,5g.
4-methyl-N-(1-thiophen-2-ylethylidene)benzenesulfonamide (CAS 958009-38-6) is a chemical compound with the molecular formula C13H13NO2S2 and a molecular weight of 279.4 g/mol. IUPAC name: 4-methyl-N-(1-thiophen-2-ylethylidene)benzenesulfonamide. InChIKey: DGEWUJOXOQCGKF-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2S2 |
|---|---|
| Molecular weight | 279.4 g/mol |
| IUPAC name | 4-methyl-N-(1-thiophen-2-ylethylidene)benzenesulfonamide |
| InChIKey | DGEWUJOXOQCGKF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N=C(C)C2=CC=CS2 |
Computed by PubChem (NCBI)