Products 20165-96-2
CAS 20165-96-2 appears in our catalog under these names: N,N-Diethylnicotinamide(Nikethamide) N'-oxide, Nicotinic Acid Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-diethyl-1-oxidopyridin-1-ium-3-carboxamide (CAS 20165-96-2) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: N,N-diethyl-1-oxidopyridin-1-ium-3-carboxamide. InChIKey: QVMCONZXDUORQS-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | N,N-diethyl-1-oxidopyridin-1-ium-3-carboxamide |
| InChIKey | QVMCONZXDUORQS-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C[N+](=CC=C1)[O-] |
Computed by PubChem (NCBI)