Products 201741-00-6
CAS 201741-00-6 is the registry number for Xylose-13C2. Offered by: MedChemExpress. Available pack sizes: 25 mg, 100 mg, 10 mg, 50 mg, 5 mg.
(2R,3S,4R)-2,3,4,5-tetrahydroxy(1,2-13C2)pentanal (CAS 201741-00-6) is a chemical compound with the molecular formula C5H10O5 and a molecular weight of 152.12 g/mol. IUPAC name: (2R,3S,4R)-2,3,4,5-tetrahydroxy(1,2-13C2)pentanal. InChIKey: PYMYPHUHKUWMLA-AZDIZYBSSA-N.
| Molecular formula | C5H10O5 |
|---|---|
| Molecular weight | 152.12 g/mol |
| IUPAC name | (2R,3S,4R)-2,3,4,5-tetrahydroxy(1,2-13C2)pentanal |
| InChIKey | PYMYPHUHKUWMLA-AZDIZYBSSA-N |
| SMILES | C([C@H]([C@@H]([13C@H]([13CH]=O)O)O)O)O |
Computed by PubChem (NCBI)