CAS 201847-51-0 is the registry number for D-Alanine 7-amido-4-methylcoumarin free base. Offered by: Biosynth. Available pack sizes: 250mg, 10mg.
(2R)-2-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide (CAS 201847-51-0) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: (2R)-2-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide. InChIKey: IWSOXHMIRLSLKT-MRVPVSSYSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | (2R)-2-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide |
| InChIKey | IWSOXHMIRLSLKT-MRVPVSSYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@@H](C)N |
Computed by PubChem (NCBI)