Products 20186-22-5
CAS 20186-22-5 appears in our catalog under these names: (S,S)–Pisatin, Pisatin, (S,S)-Pisatin, 98.66%, Pisatin, 98.0%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 2mg, 10mg, 1 mg, 5 mg.
(1S,12S)-16-methoxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-1-ol (CAS 20186-22-5) is a chemical compound with the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. IUPAC name: (1S,12S)-16-methoxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-1-ol. InChIKey: LZMRDTLRSDRUSU-DLBZAZTESA-N.
| Molecular formula | C17H14O6 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | (1S,12S)-16-methoxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-1-ol |
| InChIKey | LZMRDTLRSDRUSU-DLBZAZTESA-N |
| SMILES | COC1=CC2=C(C=C1)[C@H]3[C@@](CO2)(C4=CC5=C(C=C4O3)OCO5)O |
Computed by PubChem (NCBI)